All categories

3 years ago

Which of the following statements about balanced chemical equations is true?

Chemistry

2 answers:

faltersainse [42]3 years ago

8 0

Answer:

The answer is all three

Explanation:

Balanced chemical equations demonstrate that the total number of atoms of each element are conserved during a chemical reaction. These equations are useful because they provide the molar ratios of the reactants and products in a chemical reaction, and they allow the theoretical masses of reactants and products to be calculated.

miv72 [106K]3 years ago

3 0

Answer:

The correct answer is They provide the molar ratio of reactant and products in a chemical reaction.

Explanation:

Balanced chemical equation helps us to calculate the number of moles of both reactant and product.For example

2H2+O2=2H2O

From the above balanced equation it can be stated that 2 molecules of hydrogen(H2) reacts with 1 molecule of oxygen(O2) to form 2 molecules of water.

You might be interested in

If an atom contains more electrons than protons, it is a action, an anion, or electrically neutral

barxatty [35]

Electrons hold a negative charge, and anion refers to a negatively charged atom.

The answer is anion. Here's a way to help remember:

Cats have paws, and cations are "paws"itive (positive).

6 0

3 years ago

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

3 years ago

A 80.0 g piece of metal at 88.0°C is placed in 125 g of water at 20.0°C contained in a calorimeter. The metal and water come to

grandymaker [24]

Answer:

The specific heat of the metal is 0.485 J/g°C

Explanation:

Step 1: Data given

Mass of the piece of metal = 80.0 grams

Mass of the water = 125 grams

Initial temperature of the metal = 88.0 °C

Initial temperature of water =20.0 °C

Final temperature = 24.7 °C

pecific heat of water is 4.18 J/g*°C

Step 2: Calculate specific heat of the metal

Qgained = -Qlost

Q =m*c*ΔT

Qwater = - Qmetal

m(water)*c(water)*ΔT(water) = -m(metal)*c(metal)*ΔT(metal)

with mass of water = 125 grams

with c( water) = 4.18 J/g°C

with ΔT(water) = T2-T1 = 24.7 - 20 = 4.7°C

with mass of metal = 80.0 grams

with c(metal) = TO BE DETERMINED

with ΔT(metal) = 24.7 - 88.0 = -63.3 °C

125*4.18*4.7 = -80 * C(metal) * -63.3

2455.75 = -80 * C(metal) * -63.3

C(metal) = 2455.75 / (-80*-63.3)

C(metal) = 0.485 J/g°C

The specific heat of the metal is 0.485 J/g°C

3 0

3 years ago

!!29 POINTS!! PLS HELP ASAP

ICE Princess25 [194]

Answer:

The person who just wanted points is annoying

Explanation:

WHY WOULD YOU DO THAT

8 0

3 years ago

I need help filling out nitrogen

xxMikexx [17]

For Nitrogen Atom:
Atomic Number - 7
Protons - 7
Neutrons - 8
Electrons - 7
Cation/Anion - Anion

For Nitrogen Ion:
Atomic Number - 7
Protons - 7
Neutrons - 8
Electrons - 10
Atomic Symbol - N3-

5 0

3 years ago