Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Answer:
the answer is true
Explanation:
it is the smallest particle in an element that takes part in a chemical reaction
Answer: There are now 2.07 moles of gas in the flask.
Explanation:
P= Pressure of the gas = 697 mmHg = 0.92 atm (760 mmHg= 1 atm)
V= Volume of gas = volume of container = ?
n = number of moles = 1.9
T = Temperature of the gas = 21°C=(21+273)K= 294 K (0°C = 273 K)
R= Value of gas constant = 0.0821 Latm\K mol
When more gas is added to the flask. The new pressure is 775 mm Hg and the temperature is now 26 °C, but the volume remains same.Thus again using ideal gas equation to find number of moles.
P= Pressure of the gas = 775 mmHg = 1.02 atm (760 mmHg= 1 atm)
V= Volume of gas = volume of container = 49.8 L
n = number of moles = ?
T = Temperature of the gas = 26°C=(26+273)K= 299 K (0°C = 273 K)
R= Value of gas constant = 0.0821 Latm\K mol
Thus the now the container contains 2.07 moles.
Answer:
1.23 M
Explanation:
Molarity of a substance , is the number of moles present in a liter of solution .
M = n / V
M = molarity
V = volume of solution in liter ,
n = moles of solute ,
Moles is denoted by given mass divided by the molecular mass ,
Hence ,
n = w / m
n = moles ,
w = given mass ,
m = molecular mass .
From the question ,
w = given mass of NaCl = 7.2 g
As we know , the molecular mass of NaCl = 58.5 g/mol
Moles is calculated as -
n = w / m = 7.2 g / 58.5 g/mol = 0.123 mol
Molarity is calculated as -
V = 100ml = 0.1 L (since , 1 ml = 1/1000L )
M = n / V = 0.123 mol / 0.1 L = 1.23 M
A is obviously out because it leads to a volume of 125.0 milliliters of the new solution and gives you a lower concentration than you were aiming for.
D is out because you are adding 75 milliliters of the stock solution, so your concentration would be too high. You only need 25.0 milometers of stock solution per 100 milliliters of the new solution.
C is also out because it leads to 50.0 milliliters stock solution per 100 milliliters of the new solution and hence the wrong concentration.
B is by default the correct answer. It also details the correct technique. First you add the stock solution (This you know from your calculations to be 25 milliliters.) then you add the water up to the volume you needed. (Because the calculations only tell you the total volume of water not what you need to add) You also add the water last so you can rinse the neck of the flask to make sure you also get all the stock solution residue into the stock solution.
I would add the final step of stirring, but B is the only answer that can be correct.
