The direction of the magnetic field would be going up.
The delta H of -484 kJ is the heat given off when 2 moles of H2 react with 1 mole of O2 to make 2 moles of H2O. You don't have anywhere near that much reactants, only 1/4 as much
<span>actual delta H = 0.34 moles H2 x (-484 kJ / 2 moles H2) = 823 kJ </span>
<span>delta E = delta H - PdeltaV = 823 kJ - 0.41 kJ = 822 kJ</span>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
I have no idea how about it lol I t