The latent heat is correlated with energy as follows:
Q = mL
550 * 103 = 14 * 103 * L
L = 39.285 J /g
Thus, latent heat of the substance is 39.285 j /g
Answer:
C. the number of atoms, molecules, ions, formula units, or other particles in a mole of a substance
Explanation: Its correct
(4) chemical energy to electrical energy is the correct answer.
Hope this helps~
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Mass = 90.28 g
Explanation:
Given data:
Mass of Ca(OH)₂ = ?
Volume of solution= 1.5 L
Molarity of solution = 0.81 M
Solution:
First of all we will calculate number of moles.
Molarity = number of moles / volume in L
by putting values,
0.81 M = Number of moles / 1.5 L
Number of moles = 0.81 M × 1.5 L
Number of moles = 1.22 mol
Mass of Ca(OH)₂ in gram:
Mass = number of moles × molar mass
Mass = 1.22 mol × 74.09 g/mol
Mass = 90.28 g
