Answer:
Any substance that cannot be decomposed into simpler substances by ordinary chemical processes.
Another definition:
An element is the simplest pure substance which can neither be split nor built up from other simpler substances by chemical reaction
Answer:
group 1 and are called Alkali metals. Similarly, very active non-metals are placed in group 17
Explanation:
the answer is d. this is due to the fact a proton weighs 2000 times more then a electron
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:Score” scatter plot shows an example of a positive relationship—as one variable increases, so does the other. The points in this type of scatter plot tend to go “uphill” from left to right
Explanation:Score” scatter plot shows an example of a positive relationship—as one variable increases, so does the other. The points in this type of scatter plot tend to go “uphill” from left to right
