The mass of the atom is equal to the sum of the number of protons and the number of neutrons. In a neutral atom, the number of protons is equal to the number of electrons. The atomic number meanwhile of an atom is equal to the number of protons of the atom.
Answer:
b
Explanation:
b/c proton + neutron=mass number and
mass number - proton= neutron
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Hydrochloric acid and sodium hydroxide
HCl + NaOh ----> NaCl + H2O
Explanation:
Greenhouse gases are gases in Earth's atmosphere that trap heat. They let sunlight pass through the atmosphere, but they prevent the heat that the sunlight brings from leaving the atmosphere.