Please help me! During the replication phase, DNA:

If 45.0 mL of ethanol (density =0.789g/mol) initially at 6.0°C mix with 45.0 mL of water (density =1.0 g/mol) initially at 28.0°

Likurg_2 [28]

The final temperature of the mixture : 21.1° C

<h3>Further explanation </h3>

The law of conservation of energy can be applied to heat changes, i.e. the heat received / absorbed is the same as the heat released

Q in(gained) = Q out(lost)

Heat can be calculated using the formula:

Q = mc∆T

Q = heat, J

m = mass, g

c = specific heat, joules / g ° C

∆T = temperature difference, ° C / K

Q ethanol=Q water

mass ethanol=

$\tt mass=\rho\times V\\\\mass=0.789\times 45=35.505~g$

mass water =

$\tt mass=1~g/ml\times 45~ml=45~g$

then the heat transfer :

$\tt 35.505\times 2.42~J/g^oC\times (t-6)=45\times 4.18~J/g^oC\times (28-t)\\\\85.922t-515.533=5266.8-188.1t\\\\274.022t=5782.33\rightarrow t=21.1^oC$

5 0

3 years ago

What types of organisms are most likely to become extinct (characteristics)?

Paladinen [302]

Many rare and/or endemic species exhibit one or more of the following attributes which make them especially prone to extinction: (1) narrow (and single) geographical range, (2) only one or a few populations, (3) small population size and little genetic variability, (4) over-exploitation by people

4 0

3 years ago

Can someone help me I would really appreciate it

slega [8]

The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.

8 0

3 years ago

Use Boyle’s law to complete the following:

mixas84 [53]

Answer:

The answer to your question is: 0.25 l

Explanation:

Data

P1 = 1 atm

V1 = 0.5 l

P2 =2 atm

V2 = ?

T = constant

Formula

V1P1 = V2P2

Clear V2 from the formula

V2 = V1P1/P2

Substitution

V2 = (0.5)(1)/2 substitution

= 0.25 l result

3 0

3 years ago

The reaction for photosynthesis producing glucose sugar and oxygen gas is:

Anvisha [2.4K]

1.5 grams of glucose is produced from 2.20 g of CO₂.

To find the mass of glucose produced, first you must know the balanced reaction. For this, the Law of Conservation of Matter is followed.

The law of conservation of matter states that since no atom can be created or destroyed in a chemical reaction, the number of atoms that are present in the reagents has to be equal to the number of atoms present in the products.

So, in this case, the balanced reaction is:

6 CO₂ + 6 H₂O → C₆H₁₂O₆ + 6 O₂

By stoichiometry of the reaction (that is, the relationship between the amount of reagents and products in a chemical reaction), the amounts of moles of each reactant and product participate in the reaction:

CO₂: 6 moles
H₂O: 6 moles
C₆H₁₂O₆: 1 mole
O₂: 6 moles

So, you know that 2.20 g of CO₂ react, whose molar weight is 44.01 g/mole. By definition of molar mass, 1 mole of CO₂ has 44.01 g. So, the number of moles that 2.20 grams of the compound represent is calculated as:

$moles of CO_{2} =2.20 grams*\frac{1 mole}{44.01 grams}$

moles of CO₂= 0.05 moles

Now you must follow the following rule of three: if by stoichiometry of the reaction 6 moles of CO₂ produce 1 mole of C₆H₁₂O₆, 0.05 moles of CO₂ produce how many moles of C₆H₁₂O₆?

$moles of C_{6} H_{12} O_{6} =\frac{0.05moles of CO_{2} *1 mole of C_{6} H_{12} O_{6}}{6moles of CO_{2}}$

moles of C₆H₁₂O₆= 8.33*10⁻³

Being the molar mass of glucose 180.18 g/mole, the mass that 8.33*10⁻³ moles of the compound represent is calculated as:

$mass of glucose =8.33*10^{-3} moles*\frac{180.18 grams}{1 mole}$

mass of glucose= 1.5 grams

Then, 1.5 grams of glucose is produced from 2.20 g of CO₂.

5 0

3 years ago