It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
1. Physical matter
2. Chemical matter
3. Physical matter
4. Physical matter
5. Chemical matter
6. Physical matter.
Answer:
It has been approximately 6 hours after death.
Explanation:
This is because between 2-6 hours after death, the body starts becoming stiff from top to bottom, then spreading to the limbs. Since there is only rigor in his upper body, that would mean that with normal temperature and body conditions, it would be 4 or 5 hours after death. But since he is obese and in cold temperature, there is slower progression of rigor, leading to the maximum time in the first rigor mortis phase, 6 hours.
Answer:
Balanced equation have equal number of atoms of different elements in the side of reactants and products.