Answer: Some kind of strainer system
Explanation:
Answer:
A more dense plate going underneath a less dense plate.
The anwser is atoms are destroyed
Answer:
0.185M sulfuric acid
Explanation:
Based on the reaction:
H₂SO₄ + 2KOH → K₂SO₄ + 2H₂O
<em>1 mole of sulfuric acid reacts with 2 moles of KOH</em>
Initial moles of H₂SO₄ and KOH are:
H₂SO₄: 0.750L ₓ (0.470mol / L) = <em>0.3525 moles of H₂SO₄</em>
KOH: 0.700L ₓ (0.240mol / L) = <em>0.168 moles of KOH</em>
The moles of sulfuric acis that react with KOH are:
0.168mol KOH ₓ (1 mole H₂SO₄ / 2 moles KOH) = 0.0840 moles of sulfuric acid.
Thus, moles that remain are:
0.3525moles - 0.0840 moles = <em>0.2685 moles of sulfuric acid remains</em>
As total volume is 0.700L + 0.750L = 1.450L, concentration is:
0.2685mol / 1.450L = <em>0.185M sulfuric acid</em>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
