Answer:
<h2>2.49 g/cm³</h2>
Explanation:
The density of a substance can be found by using the formula
From the question we have
We have the final answer as
<h3>2.49 g/cm³</h3>
Hope this helps you
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
The oxidation state of the compound Mn (ClO4)3 is to be determined in this problem. For oxygen, the charge is 2-, the total considering its number of atoms is -24. Mn has a charge of +3. TO compute for Mn, we must achieve zero charge overall hence 3+3x-24=0 where x is the Cl charge. Cl charge, x is +7.
Answer:
25.35%
Explanation:
Again let me restate the the equation of the reaction;
H2O (ℓ) + 2 MnO4 - (aq) + 3 CN- (aq) → 2 MnO2 (s) + 3 CNO- (aq) + 2 OH- (aq)
Amount of potassium permanganate reacted = 10.2/1000 * 0.08035 = 8.1957 * 10^-4 moles
If 2 moles of MnO4 - reacts with 3 moles of CN-
8.1957 * 10^-4 moles of MnO4 - reacts with 8.1957 * 10^-4 * 3/2
= 1.229 * 10^-3 moles of CN-
Mass of CN- reacted = 1.229 * 10^-3 moles of CN- * 26.02 g/mol
= 0.03 g
Hence, percentage of the cyanide = 0.03 g/0.1183 g * 100
= 25.35%
Carbonic anhydrase speeds up<span> the transfer of carbon dioxide from cells to the blood.
Hope this work cuz</span>
