Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
One mole methane combusts to form one mole CO2 and 2 moles H2O
Answer:
8 mol of hydrogen will react with 1 mol of sulfur.
Explanation:
We'll begin by writing the balanced equation for the reaction.
This is given below:
8H2 + S8 —> 8H2S
Now, let us carefully observe the mole ratio of the reactants.
This is illustrated:
The mole ratio of the reactants ( i.e H2 and S8) is 8 : 1
From the balanced equation above,
We can thus, concluded that:
8 moles of H2 will reacted with 1 mole of S8.
Answer:
the process of turning from liquid into vapour.
Answer:
2,47 *
(molecules)
Explanation:
Avogadro's number is a very important relationship: 1 mole = 6,02 *
atoms, molecules, protons, etc.
To convert from moles to molecules, multiply the molar amount by Avogadro's number.
4,1 mol * 6,02 *
≈ 24,7 *
= 2,47 *
(molecules)
Therefore the third answer is correct