All categories

3 years ago

Convert 3.99 g to kilograms. 3.99 g =

Chemistry

1 answer:

bezimeni [28]3 years ago

6 0

Answer: The given mass in kilograms is 0.00399 kg

Explanation:

Gram and Kilograms are the units which are used to express the mass of a substance. These units are inter changeable.

We are given:

Mass of a substance = 3.99 g

To convert the given mass into kilograms, we use the conversion factor:

1 kg = 1000 g

Converting the given value, we get:

$\Rightarrow 3.99g\times (\frac{1kg}{1000g}=0.00399kg$

Hence, the given mass in kilograms is 0.00399 kg

You might be interested in

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

3 years ago

Translate the following chemical equation into a sentence. CH4+2O2 CO2+2H2O

muminat

One mole methane combusts to form one mole CO2 and 2 moles H2O

3 0

4 years ago

Consider the balanced equation below. 8H2 + S8 Right arrow. 8H2S Based on the mole ratios, what can most likely be predicted? 1

Arte-miy333 [17]

Answer:

8 mol of hydrogen will react with 1 mol of sulfur.

Explanation:

We'll begin by writing the balanced equation for the reaction.

This is given below:

8H2 + S8 —> 8H2S

Now, let us carefully observe the mole ratio of the reactants.

This is illustrated:

The mole ratio of the reactants ( i.e H2 and S8) is 8 : 1

From the balanced equation above,

We can thus, concluded that:

8 moles of H2 will reacted with 1 mole of S8.

7 0

4 years ago

What is evaporation ? bubblycherry101, have you left ?

Marrrta [24]

Answer:

the process of turning from liquid into vapour.

6 0

4 years ago

Read 2 more answers

How many molecules in 4.10 mol H2O?

Shtirlitz [24]

Answer:

2,47 * $10^{24}$ (molecules)

Explanation:

Avogadro's number is a very important relationship: 1 mole = 6,02 * $10^{23}$ atoms, molecules, protons, etc.

To convert from moles to molecules, multiply the molar amount by Avogadro's number.

4,1 mol * 6,02 * $10^{23}$ ≈ 24,7 * $10^{23}$ = 2,47 * $10^{24}$ (molecules)

Therefore the third answer is correct

8 0

3 years ago