About 5% of high school seniors reportmisusing prescription
Answer:
Your answer should be 15.68 grams.
Explanation:
Seeing as 1 mole has a mass of 56 g, 56*0.28 would get you 15.68 g.
It depends on the process.
Like for example if the process is isothermal(temperature is constant), you can use,
PV = constant or P1V1 = P2V2 where P1V1 are initial conditions and P2V2 are final.
For adiabatic process,
PV^gamma = constant or P1V1 ^gamma = P2V2 ^gamma.
where gamma = Cp
------
Cv
Cp = specific heat at constant pressure and Cv = specific at constant volume.
Value of Gamma will be given in question.
Hope this helps!
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane