Answer:
First you have to separate real and imaginary parts of Tan(x+iy)=Tan(z)=sin(z)/cos(z)
sinz=sin(x+iy)=sinxcos(iy)+cosxsin(iy)=sinxcoshy-icosx sinhy
cosz=cos(x+iy)=cosxcos(iy)-sinxsin(iy)=cosxcoshy−isinxsinhy
Now if you plug in Tan(z) and simplify (it is easy!) you get
Tan(z)=(sin(2x)+isinh(2y))/(cos(2x)+cosh(2y))= A+iB.
This means that
A=sin(2x)/(cos(2x)+cosh(2y)) and B= sinh(2y)/(cos(2x)+cosh(2y))
Now,
A/B=sin(2x)/sinh(2y)
If any questions, let me know.
Answer:
a)
The crack and connecting rod is used in the design of car.This mechanism is known as slider -crank mechanism.
Components:
1.Inlet tube
2. Wheel
3. Exhaust
4. Engine
5.Air tank
6.Pressure gauge
7.Stand
8. Gate valve
b)
The efficiency of air engine is less as compare to efficiency of electric engine and this is not ecofriendly because it produce green house gases.These gases affect the environment.
c)
it can run around 722 km when it is full charge.
Explanation:
Conduction:
Heat transfer in the conduction occurs due to movement of molecule or we can say that due to movement of electrons in the two end of same the body. Generally, phenomenon of conduction happens in the case of solid . In conduction heat transfer takes places due to direct contact of two bodies.
Convection:
In convection heat transfer of fluid takes place due to density difference .In simple words we can say that heat transfer occur due to motion of fluid.
Answer:
Develop a written hazard communication program
Implement a hazard communication program
Maintain a written hazard communication program
Explanation:
To find - Which of the following answer options are your employer's responsibility? Select all that apply.
Develop a written hazard communication program
Implement a hazard communication program
Maintain a written hazard communication program
Solution -
The correct options are -
Develop a written hazard communication program
Implement a hazard communication program
Maintain a written hazard communication program
All are the Responsibilities of an employer
Reason -
The most important duty of the employer is to stay alert and implement a correctly and efficiently written communication program related to hazards of the substances in the workplace.
He also has to maintain the program so that employees do not get affected.
