Answer:
a. The specific heat capacity of the gaseous ethanol is less than the specific heat capacity of liquid ethanol.
Explanation:
The heating curve is a curve that represents temperature (T) in the y-axis vs. added heat (Q) in the x-axis. The slope is T/Q = 1/C, where C is the heat capacity. Then, the higher the slope, the lower the heat capacity. For a constant mass, it can also represent the specific heat capacity (c).
Heats of vaporization and fusion cannot be calculated from these sections of the heating curve.
<em>Which statement below explains that?</em>
<em>a. The specific heat capacity of the gaseous ethanol is less than the specific heat capacity of liquid ethanol.</em> YES.
<em>b. The specific heat capacity of the gaseous ethanol is greater than the specific heat capacity of liquid ethanol.</em> NO.
<em>c. The heat of vaporization of ethanol is less than the heat of fusion of ethanol.</em> NO.
<em>d. The heat of vaporization of ethanol is greater than the heat of fusion of ethanol.</em> NO.
Answer:
Molecular weight of the compound = 372.13 g/mol
Explanation:
Depression in freezing point is related with molality of the solution as:
Where,
= Depression in freezing point
= Molal depression constant
m = Molality
m = 0.26
Molality = 
Mass of solvent (toluene) = 15.0 g = 0.015 kg
Moles of compound = 0.015 × 0.26 = 0.00389 mol
Mass of the compound = 1.450 g
Molecular weight = 
Answer:
Y = 62.5%
Explanation:
Hello there!
In this case, for the given chemical reaction whereby carbon dioxide is produced in excess oxygen, it is firstly necessary to calculate the theoretical yield of the former throughout the reacted 10 grams of carbon monoxide:
Finally, given the actual yield of the CO2-product, we can calculate the percent yield as shown below:
Best regards!
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Explanation:
The theory or working principle of Atomic Emission Spectroscopy involves the examination of the wavelengths of photons discharged by atoms and molecules as they transit from a high energy state to a low energy state. A characteristic set of wavelengths is emitted by each element or substance which depends on its electronic structure.
