Answer:
The mole fraction of ethanol and water in the solution are 0.19 and 0.81 respectively.
Explanation:
The Molar Fraction is a way of measuring the concentration that expresses the proportion in which a substance is found with respect to the total moles of the solution, which are calculated by adding the moles of solute (s) and solvent.
It is calculated by dividing the number of moles of one of the components by the total number of moles of the solution.
The sum of all the molar fractions of the substances present in a solution is equal to 1.
So, the expression to calculate the mole fraction is:

Being the molar mass of the compounds:
- Ethanol 46
- Water 18

the number of moles that represent the mass quantities is calculated as:
- Moles of ethanol: 300 grams*
= 6.52 moles
- Moles of water: 500 grams*
= 27.78 moles
So the total moles in solution are 6.52 moles + 27.78 moles = 34.3 moles
The mole fraction of ethanol in the solution is calculated as:


The mole fraction of water in the solution is calculated as:


Then:


<u><em>The mole fraction of ethanol and water in the solution are 0.19 and 0.81 respectively.</em></u>
.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
When a metal undergoes a reaction, especially with a nonmetal, you should look for the formation of salts or the formation of precipitates in the case the product is not soluble to water. Metals loses electrons to form positive ions which then reacts to nonmetals that are negatively charged ions.<span />
Yes
Explanation:
Valence electrons on the periodic table of elements shows a repeating or periodic pattern. There is a noticeable pattern that can be deduced from the valence electrons in the orbitals of atoms.
Valence electrons are the electrons in the outermost shell of an element
The periodic table arranges elements based on their atomic numbers. This number denotes the number of protons or electrons an atom contains.
- The table is divided into groups which are the vertical columns into which elements are classified.
- The horizontal rows are called periods.
- A period begins with one valence electron and ends with an atom having complete outer shell structure of an inert gas.
- Down a group the valence electron is the same. The group number denotes the number of valence electrons in a group. Group 1 has just one valence electron in their outermost shell.
Learn more:
Valence electrons brainly.com/question/12580690
Periodic table brainly.com/question/2014634
#learnwithBrainly