Answer: The gas generated by two antacid tablets has a smaller volume.
Explanation:
Since the antiacid is the limiting reagent, we know that the more tablets there are, the more gas there will be.
This means that there will be more gas generated by the four antiacid tablets when compared to the two antiacid tablets, which gives us that the gas generated by the two antiacid tablets has a smaller volume.
Any substance changes to another substance that means the change of the physical property. Like water () has different state which changes as the temperature changes. It remain as liquid in the room temperature, in solid form at or below 0°C and vapor phase on or above 100°C. But in all the stage or phase of the substance the composition of the water i.e. remains. Thus the chemical property remains fixed when a substance change to other substance.
Answer:
HBrO4 < HBrO3 < HBrO2 < HBrO
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Weathering of the rock and sedimentation are decomposition processes. Through time, the minerals in the rocks soften due to pressure and heat. So, they crumble down and reduce in terms of size. Once they do, they become sand or part of the soil. So, the answer is A.
