━━━━━━━☆☆━━━━━━━
▹ Answer
<em>x¹⁰z¹⁵</em>
▹ Step-by-Step Explanation
x¹²z¹¹/x²z⁴
<u>Reduce</u>
x¹⁰z¹¹ * z⁴
<u>Calculate</u>
x¹⁰z¹⁵
Hope this helps!
- CloutAnswers ❁
Brainliest is greatly appreciated!
━━━━━━━☆☆━━━━━━━
Answer:
has Two oxygen atoms
Explanation:
Oxygen is a diatomic element hence exists as O2 for majority of its existence in our atmosphere. Although small portion does exist in form of O3 which protects earth from sun's harmful ray, the majority portion of oxygen has O2 which is the oxygen we breathe.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
C. Arsenic
Explanation:
Each period is terminated by a noble gas with a closed valence shell with electronic configuration ns²np⁶. Since noble gases have completely filled orbitals in the valence shell and are very stable, it becomes very difficult to alter their stable arrangement by the addition or removal of electrons. They they exhibit very low chemical reactivity
Noble gas elements are: Neon, Argon, Krypton, Xenon, Radon, Helium (2 electrons in outer shell, stable).
Answer : The correct option is, (a) Synthesis
Explanation :
Synthesis reaction : A chemical reaction where multiple substances or reactants combine to form a single product.
It is represented as,

Combustion reaction : A chemical reaction in which a hydrocarbon react with the oxygen to give product as carbon dioxide and water.
It is represented as,

Single replacement reaction : A chemical reaction in which the more reactive element replace the less reactive element.
It is represented as,

In this reaction, A is more reactive element and B is less reactive element.
Double replacement reaction : It is a type of chemical reaction where a positive cation and a negative anion of two reactants exchange places to form two new products.
It is represented as,

(X and A are the cations, Y and B are the anions)
The given reaction is, 
In this reaction, calcium combine with the chloride to form calcium chloride as a product.
Hence, the given type of reaction is a synthesis reaction.