A geologist would ask the analytical chemist to identify the rock's composition. Chemists gather data from afar and analyze matter back to earth.
<h3>Who is a geologist ?</h3>
A geologist is a scientist who focuses on the processes that shape terrestrial planets and the solid, liquid, and gaseous stuff that makes up Earth. Although training in physics, chemistry, biology, and other sciences are sometimes helpful, geologists typically pursue geology as their field of study. Geology includes a significant amount of field study (field work), even if many of its subdisciplines also involve laboratory and computer work.
Geologists look for natural resources like oil, gas, precious and base metals in the energy and mining industries. They are also in the vanguard of efforts to prevent and lessen the effects of natural disasters and hazards like earthquakes, volcanoes, tsunamis, and landslides.
To learn more about geologist from the given link:
brainly.com/question/25762503
#SPJ4
Monocots<span> have only one seed leaf inside the seed coat. It is often only a thin leaf, because the endosperm to feed the new plant is not inside the seed leaf. </span>Dicots <span>have two seed leaves inside the seed coat. They are usually rounded and fat, because they contain the endosperm to feed the embryo plant.
</span><span>
</span>
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Gay-Lussacs law states that pressure is directly proportional to temperature at constant volume.
in this case the volumes of the 2 containers remain the same therefore volume is constant.
P/ T = k
where P - pressure, T - temperature and k - constant
when temperature decreases the pressure too decreases and vice versa.
if temperature of one container is lowered the pressure also reduces.
since one containers temperature is lowered the pressure in that container reduces.
answer is when temperature is lowered, pressure too is lowered.
