The new volume of the gas wii be 4.7 liters.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Antoine Lavoisier was part of a wealthy family in Paris. He pursued to study science upon realizing that chemistry or the study of the elements was not a well-studied field. His discovery of that air was a mixture of nitrogen and oxygen gave rise to the concept of COMBUSTION after repeating the experiments made by Priestly using mercury and other metal oxides.
The event was such a history-making because it disproved that concept that air was a pure substance along with 3 others: earth, fire, and water.
Answer:
2.07 mol O₂
Explanation:
First we need to write down the species present in the chemical equation, using the information given by the exercise:
However this equation <em>is not balanced</em>, so now we<u> balance it</u>:
Now we can use the stoichiometric ratio to <u>calculate the moles of oxygen </u>from the moles of sulfide dioxide:
- 1.38 molSO₂ *
= 2.07 mol O₂
It has 49 electrons as well. The amount of protons and electrons are equal.