Feature E on the map is composed of glacial till.What type of glacial till is E, and how did it form?

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

3 years ago

How many moles of argon would you have if you have 25 L of argon?

Anarel [89]

Answer: 39.948 grams

Explanation:

The SI base unit for amount of substance is the mole. 1 mole is equal to 1 moles Argon, or 39.948 grams

4 0

3 years ago

In a titration of 47.41 mL of 0.3764 M ammonia with 0.3838 M aqueous nitric acid, what is the pH of the solution when 47.41 mL +

Volgvan

Answer: The pH of the solution is 1.136

Explanation:

To calculate the moles from molarity, we use the equation:

$\text{Molarity of the solution}=\frac{\text{Moles of solute}}{\text{Volume of solution (in L)}}$

For ammonia:

Molarity of ammonia = 0.3764 M

Volume of ammonia = 47.41 mL = 0.04741 L (Conversion factor: 1 L = 1000 mL)

Putting values in above equation, we get:

$0.3764mol/L=\frac{\text{Moles of ammonia}}{0.04741L}\\\\\text{Moles of ammonia}=0.01784mol$

For nitric acid:

Molarity of nitric acid = 0.3838 M

Volume of ammonia = (47.41 + 10.00) mL = 57.41 mL= 0.05741 L

Putting values in above equation, we get:

$0.3838mol/L=\frac{\text{Moles of nitric acid}}{0.05741L}\\\\\text{Moles of nitric acid}=0.02203mol$

After the completion of reaction, amount of nitric acid remained = 0.022 - 0.0178 = 0.0042 mol

For the reaction of ammonia with nitric acid, the equation follows:

$NH_3+HNO_3\rightarrow NH_4NO_3$

At $t=0$ 0.0178 0.022

Completion 0 0.0042 0.0178

As, the solution of the reaction is made from strong acid which is nitric acid and the conjugate acid of weak base which is ammonia. So, the pH of the reaction will be based totally on the concentration of nitric acid.

To calculate the pH of the reaction, we use the equation:

$pH=-\log[H^+]$

where,

$[H^+]=\frac{0.0042mol}{0.05741L}=0.0731M$

Putting values in above equation, we get:

$pH=-\log(0.0731)\\\\pH=1.136$

Hence, the pH of the solution is 1.136

8 0

3 years ago

Why do heart diseas patient's eat oil instead of fat?

7nadin3 [17]

Answer:

lube

Explanation:

8 0

3 years ago

Read 2 more answers

Please help I am stuck

Ksenya-84 [330]

The theory of plate tectonics tells exactly where the continents were before Pangaea divided.

I'm not a 100% sure but I feel strong about is

8 0

3 years ago