Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
T = 20 % : 20 / 100 = 0.2
m1 = solute
m2 = Solvent
T = m1 / m1 + m2
0.2 = 500 g / 500 g + m2
0.2 * ( 500 + m2 ) = 500
0.2 * 500 + 0.2 m2 = 500
100 + 0.2 m2 = 500
0.2 m2 = 500 - 100
0.2 m2 = 400
m2 = 400 / 0.2
m2 = 2000 g of water
hope this helps!
It causes the water to evaporate from the earths surface so that it can cycle through again
Answer:
Solar energy is a renewable free source of energy
Explanation:
It is sustainable and totally inexhaustible, unlike fossil fuels which are finite. It is also a non-polluting source of energy and it does not emit any greenhouse gases when producing electricity.
Answer:
29.575%
Explanation:
Data provided:
Calories taken in daily diet = 2000
Recommended amount of fat = 65 grams
Average number of calories for fat = 9.1 calories / g
Thus,
Number of calories in the diet with average number of calories for fat
= Recommended amount of fat × Average number of calories for fat
= 65 × 9.1
= 591.5 calories
Therefore,
the percentage of calories in his diet supplied = ( 591.5 / 2000 ) × 100
= 29.575%