Answer: Peer-reviewed journal article is the most useful because the information in them had been carefully scrutinized and aproved by people who are experts in that particular field.
Fission reactions generate thermal energy
B). light energy is not required to proceed
Explanation:
In the Calvin cycle of photosynthesis, light energy is not required. The Calvin cycle is light independent and it is made up of a series of redox reactions.
- During photosynthesis reactions, green plants manufacture their food using carbon dioxide, sunlight and water.
- During the Calvin cycle aspect, light energy is not required for chemical reactions to take place. The light energy helps to move electrons.
- The cycle is also known as dark reactions.
- It is at this stage that carbon dioxide combines with water to form glucose.
- The reaction is initiated with light energy which produces NADPH and ATP.
- The Calvin cycle follows by using the NADPH and ATP to produce glucose in the dark phase.
Learn more:
ATP brainly.com/question/2953868
Light dependent reactions brainly.com/question/6866300
#learnwithBrainly
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543