Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer:
Open spaces in water's solid structure makes its solid state less dense than its liquid state.
Explanation:
- Water unlike other liquids is special. It contracts when cooled, down to a temperature of 4°C but thereafter begins to expand as it reaches 0°C and turns into ice.
- This property is useful for the preservation of marine life in very cold temperatures. During winter, the surface water in water lakes and rivers starts cooling. Upon reaching the temperature of 4°C, the surface water descends to the bottom as it denser.
- This help in the maintenance of temperature of the water at the bottom at 4°C. It is in this layer that marine life is sustained.
Answer:
0.153M
Explanation:
57.3/97.994 (molar mass)=0.585 moles of H3PO4
.0585/3.820L=0.153M
Answer:
Explanation:
Hello,
In this case, the first step is to compute the molar mass of carbon dioxide as shown below, considering it has one carbon atom and two oxygen atoms:
It is important to notice it is the mass in one mole of such compound. Afterwards, we need to use the Avogadro's number to compute the how many moles are in the given molecules of carbon dioxide as shown below:
Finally, the mass by using the molar mass:
Best regards.
The definition of heat transfer through convection involves the movement of a fluid that causes heat to move away from a hear source. That being said, convection can take place in a lake, air inside, and air outside since both liquids and gasses are considered to be fluids.
I hope this helps.
Let me know if anything is unclear.
