The answer is B
Homozygous mean the same and you know that the two alleles will be the same (either BB or bb) and receive is usually the lower case set of alleles
Answer:
5 moles of Fe
Explanation:
The equation of the reaction is;
2 Al(s) + Fe 2O 3(s) --> 2Fe (s) + Al 2O 3 (s)
Now;
1 mole of Fe2O3 require 2 moles of Al
3 moles of Fe2O3 requires 3 × 2/1 = 6 moles of Al
Hence Al is the limiting reactant.
If 2 moles of Al yields 2 moles of Fe
5 moles of Al yields 5 × 2/2 = 5 moles of Fe
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
The oxidation state of N in the KNO3 is +5
Explanation:
Oxidation rules:
1. Oxygen is -2, unless in peroxides.
2. Group 1 metals = +1
3. Group 2 metals = +2
4. If the molecule is neutral, all of the oxidation numbers have to add up to zero.
5. If the molecule is charged, all of the oxidation numbers have to add up to the charge of the molecule.
So, the given formula represents the salt compound formula unit of potassium nitrate: KNO3
The formula unit is uncharged.
From our rules, we know that,
O = -2
And we can find K on the periodic table, in the first group, thus giving it a +1 charge. Now let's put it all together.
K = +1
N = x
O = -2
Let's take into account the number of atoms of each element we have and make an equation since we know everything has to add up to zero since the molecules are neutral.
+1 +x+3 (-2) = 0 (notice we multiplied 3 by -2 because in the formula we have 3 atoms of oxygen with -2 charge each)
x - 5 = 0
x = 5
Therefore, the oxidation number of N in KNO3 is +5.
