It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer: Catalyst
Explanation: it speeds it up lol but basically the catalyst helps speed up the chemical reaction by reducing the activation energy or changing the reaction machenism/
C.) both secrete toxins and have thorns (It simply depends on what kind of plant it is)
Because it requires lots of electricity to turn it into an aqueous solution so that electrolysis can be performed on it.
