Answer: (C) Dissolution is the process by which a solute form a solution in a solvent.
Explanation: Dissolution can be described as the process by which a solute dissolves in a solvent to give a solvent.
The solute may be a solid, liquid or gas and solvent is usually a liquid but can also be liquid, gas or supercritical fluid. The most common solvent is water and it is referred to as the universal solvent.
Example are:
1.Stirring of sugar in water.
In this case the solute is the sugar and the solvent is water.
2.Organic substances dissolves readily in solvent like kerosene and benzene and they are known as non-polar solvent while the organic substances are the solute
Answer:
11552.45 years
Explanation:
Given that:
Half life = 5730 years
Where, k is rate constant
So,
The rate constant, k = 0.00012 years⁻¹
Using integrated rate law for first order kinetics as:
Where,
is the concentration at time t
is the initial concentration
Given that:
The rate constant, k = 0.00012 years⁻¹
Initial concentration
= 160.0 counts/min
Final concentration
= 40.0 counts/min
Time = ?
Applying in the above equation, we get that:-

Answer:
Isotopes of an element share the same number of protons but have different numbers of neutrons. Let's use carbon as an example. There are three isotopes of carbon found in nature – carbon-12, carbon-13, and carbon-14. All three have six protons, but their neutron numbers - 6, 7, and 8, respectively - all differ.
Explanation:
Answer:
43.89 min
Explanation:
Given that:-
The speed of light = 
The distance = 
The conversion of distance in km to distance into m is shown below as:-
1 km = 1000 m
So,
Distance = 
The relation between speed distance and time is shown below as:-

Thus,


Time = 2633.33 seconds
Also, 1 s = 1/60 min
So,
Time=
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs