Answer: option C. Copper (II) chloride
Explanation:
To name CuCl2, we need to know the oxidation state of Cu in the compound as chlorine always have oxidation on —1 in all its compound. The oxidation state of Cu can be calculated as follows:
Cu + 2Cl = 0 (since the compound has no charge)
Cl = —1
Cu + 2(—1) = 0
Cu —2 = 0
Collect like terms
Cu = 0 +2
Cu = +2
Therefore, the oxidation state of Cu in CuCl2 is +2.
The name of the compound will be copper(ii) chloride, since cupper has oxidation state +2 in the compound.
In order to change celcius to kelvin always add 73 to it leaving you with -195.93
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Answer: Nitrogen
Explanation: Nitrogen has an atomic number of 7 and an atomic mass of about 14 u
