Conversion of mole to grams
k in mole = 1 mole/ atomic mass
K in mole =1/ 39.0983 g/mole
= 0.255765 g/mole
converting 40 grams of K
K 40 grams x [ 1 mole/ 39.0983 grams] = 1.0230623 mole
There are 1.0230623 moles of K in 40 K of Potassium
<span> UV radiation are high energy radiations and they are mutation causing agents so
</span>Mutagen <span> best describes the relationship of solar UV radiation to the environment
so option A is correct
hope it helps</span>
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Here’s the answer to your question :)