Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
More/ Alot? I think is what you are looking for?
Explanation:
It will definitely have some but I'm not sure on what word you are looking for.
<span>a. x and y are atoms of the same element.
If both atoms contain the same amount of protons, they are always the same element.
</span>
Answer:
Here
Explanation:
This is an acid-base reaction (neutralization): CaCO3 is a base, HCl is an acid.
Answer:
2Li(s) + 2H₂O(ℓ) ⟶ 2Li⁺(aq) + 2OH⁻(aq) + H₂(g)
Explanation:
An ionic equation uses the symbols (aq) [aqueous] to indicate molecules and ions that are soluble in water, (s) [solid] to indicate insoluble solids, and (ℓ) to indicate substances (usually water) in the liquid state.
In this reaction, solid lithium reacts with liquid water to form soluble lithium hydroxide and gaseous hydrogen
.
1. Molecular equation
2Li(s) + 2H₂O(ℓ) ⟶ 2LiOH(aq) + H₂(g)
2. Ionic equation
Lithium hydroxide is a soluble ionic compound, so we write it as hydrated ions.
2Li(s) + 2H₂O(ℓ) ⟶ 2Li⁺(aq) + 2OH⁻(aq) + H₂(g)