The Best Answer: 1 - (.47+.23) = 0.30
If Ne has a mole fraction of 0.47 (or 47/100) and Ar is 0.23, then H2(or He) has a mole fraction of 0.30
This means the gas mixture is 30/100 H2(or He).
7.85 x 0.30 = 2.355 atm
The amount of the solute present in the given solution is called the concentration. The best way to represent the concentration of the solution is ![\rm [K_{2}CrO_{4}].](https://tex.z-dn.net/?f=%5Crm%20%5BK_%7B2%7DCrO_%7B4%7D%5D.)
<h3>What is molar concentration?</h3>
Molar concentration is the molarity of the solution that is the measure of the concentration of the solute dissolved in the solution.
The formula for calculating molar concentration is given as,

The concentration of any substance is represented in the square bracket like
or ![\rm [K_{2}CrO_{4}].](https://tex.z-dn.net/?f=%5Crm%20%5BK_%7B2%7DCrO_%7B4%7D%5D.)
Therefore, option B.
is the representation of the concentration.
Learn more about the molarity here:
brainly.com/question/1532164
Answer:A
Explanation:becuse they waste less heat energy
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane