Answer:
atm
Explanation:
As we know that
Where P is the pressure in atmospheric pressure
T is the temperature in Kelvin
R is the gas constant 
V is the volume in liters
Substituting the given values in above equation, we get -
On rearranging, we get
atm
Hello!
Understanding how much of a product is produced in a reaction is referred to as Stoichiometrically understanding the reaction.
Stoichiometry is the calculation of the quantitative relationships between reactants and products in a chemical reaction. The first to talk about stoichiometry was Jeremias Benjamin Ritcher, who said that "Stoichiometry is the science that measures the quantitative proportions or mass ratios of chemical elements that are involved in a chemical reaction".
To calculate how much of a product is produced in a reaction, Stoichiometry is used, applying the law of conservation of mass. That means that the amount of product can be calculated from the amounts of reactants if they are known.
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
Answer:
3.47 minutes
Explanation:
First we must convert the distance travelled from miles to kilometres
Since ;
1 mile= 1.6093 km
3.6 miles= 3.6 × 1.6093 km = 5.79 Km
Substitute this into
Speed= distance / time
Speed = 100Kmhr-1
Distance= 5.79 Km
Time= the unknown
Time = distance/speed
Time = 5.79/100
Time= 0.0579 hours
Since;
60 minutes make one hour
x minutes make 0.0579 hours
x = 60 × 0.0579 hours
x= 3.47 minutes
C is a mixture!!!!!!!!!!!!!
