Answer:
Fe2O3 + 3CO → 2Fe + 3CO2
Explanation:
the numbers in front are the numbers you need
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Answer:
Average speed of helium is higher than argon.
Explanation:
The average speed of helium is higher than argon atom under the conditions specified because of lower mass of the helium atom as compared to argon atom. Average speed of an atom is inversely proportional to mass of the atom. If mass of an atom decreases, the atom moves with higher speed while on the other hand, if the mass of an atom increases the average speed of an atom decreases.
For this problem, the solution is exhibiting some colligative properties since the solute in the solution interferes with some of the properties of the solvent. We use equation for the boiling point elevation for this problem. We do as follows:
<span>
ΔT(boiling point) = (Kb)mi
</span>ΔT(boiling point) = (0.512)(1.3/2.0)(2)
ΔT(boiling point) = 0.67 degrees Celsius
<span>
T(boiling point) = 100 + 0.67 = 100.67 degrees Celsius</span>
