Answer:
205 K (to 3 significant figures)
Explanation:
Assuming that 4 moles of the gas behaves like an ideal gas and obey the kinetic molecular theory.
Let's apply the ideal gas law, pV= nRT.
Here p denotes the pressure of the gas, V is for volume, n is the number of moles of the gas, R is the universal gas constant and T is the temperature.
Substitute the given information into the equation:
5.6 atm ×12 L= 4 mol ×R ×T
Since pressure is in atm and volume is in L, we can use R= 0.08206 L atm K⁻¹ mol⁻¹.
5.6 atm ×12 L= 4 mol ×0.08206 L atm K⁻¹ mol⁻¹ ×T
T= 67.2 ÷0.32824
T= 204.73 (5 s.f.)
T= 205 K (3 s.f.)
Answer: A-2 energy levels
Explanation:
Sorry if i’m wrong
Answer:
Atom is a the smallest particle of a chemical element that can exist.
Molecules is a a group of atoms bonded together, representing the smallest fundamental unit of a chemical compound that can take part in a chemical reaction.
Particles is a minute portion of matter.
A particle can be a single atom or a molecule ( a group of atoms held together by chemical bonds).
Sugar is an example of a compound, while koolaid is an example of a homogeneous mixture (more specifically, a solution). A compound is a combination of 2 or more different kinds of atoms chemically bonded in a set ratio. A mixture is a combination of 2 or more substances.
answer is koolaid is a mixture
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
