PKa = -log (Ka) = log [HPO4(2-)] - log[H+]^2 = - log(4.2×10^-13)
pH = - log [H+]
- log [H+]^2 = - 2 log [H+]
2pH = - log (4.2×10^-13) - log [HPO4(2-)]
2pH = - log (4.2×10^-13) - log (0.550)
pH = 6.32
2.6 M hBr
This would be the correct answer.
<u>Answer:</u>
The principle of faunal succession state <em>"Specific groups of organisms have followed one another in a definite sequence through the Earth's history."</em>
<u>Explanation:</u>
Faunal succession basically means is that the fossils of the flora and fauna of different eras can be found in a specific order and never in the same strata. This allows the geologists to determine the time sequence and also to identify the various strata by dating the fossils that are found in each of them. The older version of fossils are found beneath the fossils of modified versions. For example fossils of simple feathers that cannot support flight are found to be succeeded by fossils of more complex feathers.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
0.0025moles
Explanation:
Molarity of a solution (M) = number of moles (n) ÷ volume (V)
According to this question, to make 250 mL of a 0.01 M solution of CaCl, the following number of moles is needed:
Volume = 250mL = 250/1000 = 0.250Litres.
Using; molarity = n/V
0.01 = n/0.250
n = 0.0025
n = 2.5 × 10^-3 moles.
