Answer:
2.down is hypotheses and 23.across is experiment
Explanation:
akechis pancakes
I believe that would be a decomposer
Number of O atoms : 24
<h3>Further explanation</h3>
Given
C₆H₁₂O₆ compound
Required
Number of atoms
Solution
A molecular formula shows the number of atomic elements in compound.
The empirical formula is the smallest comparison of the atoms
Glucose-C₆H₁₂O₆ is composed of 3 elements, namely C, H, and O.
The number of atoms in a compound can usually be seen from the subscript number after the atom and the reaction coefficient shows the number of molecules
So number of O atoms :
= 4 x 6 = 24 atoms
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs