Answer:
They have electrons in their 3d- and 4s-orbital for bond formation.
Explanation:
d- metals or transition metal are metal which form ion with partially filled d-orbital. Examples are iron and manganese.
The metals have 2 electrons in their 4s orbital. If only this is used for bonding, they will form compounds where they have oxidation State of +2 as seen in MnO.
If two 4s and one of 3d electrons are used, oxidation state of +3 is formed as seen in FeCl3.
If two 2s electron I used with two 3d electrons, compound with oxidation state of +4 is formed as seen in MnO2
It has the most mass. but the electron cloud takes up the most space.
Answer:
ligmaballlschock3 on a cocktail
Explanation:
nalls
Mean: the average. you have to add the values of the numbers and then divide by the amount of numbers there are. a common mistake to avoid is forgetting to divide the numbers at the end or subtracting them instead of adding.
mean: the middle number. you would first need to order the numbers from least to greatest. a common mistake to avoid is finding the middle number before ordering it from least to greatest
these two can also be commonly mistaken for one another because of the similar spelling.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
