The answer is B
If one circuit fails, it is most likely that all the components in the circuit will fail.
<span>Using PV=nRT to find the moles and then convert back.
</span><span>4x=.8944
</span><span>solve for x then use the pressure for lets say CO2 put that into PV=nRT then solve for n then convert over.
</span>
<span>(.2236)(2)/(298*.08206) = .0183*96g/mol = 1.76g
</span>
<span>For C:
[NH3]^2[CO2][H2O] = Kp
x=0.2236
(2*.2236)^2(.2236)*(.2236)
=0.001
</span>
The objects which cannot be observed in detail without a microscope
include the following:
<h3>What is a Microscope?</h3>
A microscope is an instrument which is used to view smaller objects such as
microbe,cells, tissues etc. This instrument is used in viewing the different
cells found in the body as they can't be seen with the eye.
The remaining options which can be seen with the eyes don't require
the use of microscopes.
Read more about Microscope here brainly.com/question/25268499
Because there is less of it available.
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
