<h3>
Answer:</h3>
The total concentration of ions in a 0.75 M solution of HCl is 1.5 M
That is; 0.75 M H⁺ and 0.75 M Cl⁻
<h3>
Explanation:</h3>
- Concentration or molarity is the number of moles of a compound or an ion contained in one liter of solution. It is measured in moles per liter (M).
- The concentration of ions making a compound is determined by the ratio of moles of the compound and the constituents ions.
- For instance, HCl dissociates to give H⁺ and Cl⁻
HCl(aq) → H⁺(aq) + Cl⁻(aq)
- Therefore, since the mole ratio between HCl and the constituent ions H⁺ and Cl⁻ is 1:1, then 0.75 M of HCl dissociates to give 0.75 M H⁺ and 0.75 m Cl⁻
- Hence the total concentration of ions in a 0.75 M solution of HCl is 1.5 M (0.75 M H⁺ and 0.75 M Cl⁻)
Explanation:
nuclear fusion yields more energy than nuclear fission and the products of the reaction are not radioactive
Answer:
1. When observing a positive test for the jones reagent and negative for the Lucas test, it indicates that it is in the presence of a primary alcohol.
Jones reagent behaves like a strong oxidant, where it transforms the primary alcohols into carboxylic acids and the secondary alcohols into ketones. Tertiary alcohols do not react.
With the Lucas test, tertiary alcohols react immediately producing turbidity, while secondary alcohols do so in five minutes. Primary alcohols do not react significantly with Lucas reagent at room temperature.
2. No reaction (See the attached drawing)
3. (see the attached drawing)
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane