Fe (s) + S (I) --> Fes (s) In the experiment above, 7.62 g of Fe

The advantage of asexual reproduction is.

Nataly_w [17]

B. reproduction doesn’t require mate

6 0

3 years ago

Draw the alcohol that is the product of the reduction of 3-methylpentanal.

natali 33 [55]

Answer: The product from the reduction reaction is

CH3-CH2-CH(CH3)-CH2-CH2OH

IUPAC name; 3- Methylpentan-1-ol

Explanation:

Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.

Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal

CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;

3-methylpenta-1-ol .

The structure of the product is:

CH3-CH2-CH(CH3)-CH2-CH2OH

7 0

3 years ago

According to the following reaction, how many grams of nitrogen monoxide will be formed upon the complete reaction of 31.0 grams

Mumz [18]

23.227 grams of NO is formed upon the complete reaction of 31.0 grams of oxygen gas with excess ammonia.

Explanation:

The balanced chemical equation is:

4NH3 + 5O2 ⇒ 4NO + 6H20

Number of moles will be calculated.

31 grams of oxygen is given

atomic weight of oxygen gas i.e O2 = 32gm/mole

The molar mass of oxygen gas is 32 grams/mole which is equal to one mole of the molecule.

Number of moles (n) = $\frac{mass}{atomic mass of one mole of the substance}$

n= $\frac{31}{32}$

n = 0.968 moles of oxygen are given for the reaction to occur.

From the balanced chemical equation it can be seen

5 moles of oxygen yielded 4 moles of NO

So, 0.968 moles of oxygen yield x moles of NO

$\frac{4}{5}$ = $\frac{x}{0.968 }$

4 × 0.968 =5x

x = 0.774 moles of NO will be formed.

To calculate the mass of NO

mass= atomic mass x number of moles

atomic mass of NO is 30.01 grams/mole

putting the values in the formula:

mass = 30.01 x 0.774

= 23.227 grams of NO is formed.

8 0

3 years ago

Compare the molecular shape and hybrid orbitals of PF3 and PF5 molecules

MaRussiya [10]

PF3 is phosphorustrifluoride with p in the center and three f bonding with it.PF5 is phosphoruspentafluoride with p in the middle and 5 f linking to bond

5 0

3 years ago

Read 2 more answers

which statement correctly explains how magnesium and chlorine combine to form magnesium chloride? A) A Cl atom donates two elect

DiKsa [7]

Answer: D) An Mg atom donates one electron to each of the two Cl atoms.

Explanation: Ionic compound is formed by transfer of electrons from metal to non metal.

For formation of a neutral ionic compound, the charges on cation and anion must be balanced. The cation is formed by loss of electrons by metals and anions are formed by gain of electrons by non metals.

Here magnesium is metal with atomic number 12 and chlorine is a non metal with atomic number of 17.

$Mg:12:1s^22s^22p^63s^2$