Answer:
0.238 M
Explanation:
A 17.00 mL sample of the dilute solution was found to contain 0.220 M ClO₃⁻(aq). The concentration is an intensive property, so the concentration in the 52.00 mL is also 0.220 M ClO₃⁻(aq). We can find the initial concentration of ClO₃⁻ using the dilution rule.
C₁.V₁ = C₂.V₂
C₁ × 24.00 mL = 0.220 M × 52.00 mL
C₁ = 0.477 M
The concentration of Pb(ClO₃)₂ is:
The units of molar mass is g/mol that is the letter B.
Stir the water continuously, this is the only logical answer. Adding powdered sugar, decreasing the volume, increasing the amount of suga, cooling, all don't make the sugar dissolve quicker.
Answer:
Demisty = mass/volume = 142/ (2×2×4) = 142 / 16 =
8.875g/cm^3
Explanation:
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
