All categories

3 years ago

The picture below shows the positions of the Earth, Moon, and Sun during an eclipse.

Chemistry

2 answers:

SVETLANKA909090 [29]3 years ago

7 0

Answer:

it is option c liner eclipse

IRISSAK [1]3 years ago

3 0

Answer:

A-It is a lunar eclipse, in which the Earth casts a shadow on the Moon.

You might be interested in

"To determine the amount of heroin in the mixture, you dissolve 1.00 g of the white powdery mixture in water in a 100.0-mL volum

UkoKoshka [18]

Explanation:

Formula to calculate osmotic pressure is as follows.

Osmotic pressure = concentration × gas constant × temperature( in K)

Temperature = $25^{o} C$

= (25 + 273) K

= 298.15 K

Osmotic pressure = 531 mm Hg or 0.698 atm (as 1 mm Hg = 0.00131)

Putting the given values into the above formula as follows.

0.698 = $C \times 0.082 \times 298.15 K
$

C = 0.0285

This also means that,

$\frac{\text{moles}}{\text{volume (in L)}}$ = 0.0285

So, moles = 0.0285 × volume (in L)

= 0.0285 × 0.100

= $2.85 \times 10^{-3
}$

Now, let us assume that mass of $C_{12}H_{23}O_{5}N$ = x grams

And, mass of $C_{12}H{22}O_{11}$ = (1.00 - x)

So, moles of $C_{12}H_{23}O_{5}N = \frac{mass}{\text{molar mass}}$

= $\frac{x}{369}$

Now, moles of $C_{12}H_{22}O_{11} = \frac{(1.00 - x)}{342}$

= $\frac{x}{369} + \frac{(1.00 - x)}{342}$

= $2.85 \times 10^{-3}$

= x = 0.346

Therefore, we can conclude that amount of $C_{12}H_{23}O_{5}N$ present is 0.346 g and amount of $C_{12}H_{22}O_{11}$ present is (1 - 0.346) g = 0.654 g.

4 0

3 years ago

If the concentration of nucleophile increases does the reaction go faster

Kay [80]

Depends on the situation. If the nucleophile is already in excess, then no the reaction will not occur faster

4 0

4 years ago

Which color of light bends the least when passing through a prism?

Allushta [10]

"RED" color bends the least when passing through a prism.

3 0

3 years ago

Can someone help me I would really appreciate it

slega [8]

The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.

8 0

4 years ago

The electron configuration of an element is 1s22s22p63s1 Describe what most likely happens when an atom of this element comes ne

trasher [3.6K]

Answer:

They will create an ionic bond.

Explanation:

The atom with the one valence electron will lose its one, because it's a metal and metals will lose electrons to become stable. The nonmetal (with 7 valence electrons) will gain that electron, therefore creating a stable octet for the nonmetal, making the compound stable.

3 0

2 years ago