Answer:
The process of photosynthesis occurs when green plants use the energy of light to convert carbon dioxide (CO2) and water (H2O) into carbohydrates. Light energy is absorbed by chlorophyll, a photosynthetic pigment of the plant, while air containing carbon dioxide and oxygen enters the plant through the leaf stomata.
Answer:
c and d are correct
Explanation:
In A, false because in Valence Electrons, the more the valences, the more stable an atom is.
In B, false because atoms cannot readily gain or lose valence electrons as the number of valence electrons is determined by the column they are in.
In C, true because the more the valence electrons, the more the stability of an atom.
In D, true as electron placing is important and the reactivity of an atom is important.
So C and D are true!
A single ringed nitrogeo base is thymine (C)
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
