All categories

3 years ago

22. Which statement best describes the use of catalytic converters in automobiles?

Chemistry

1 answer:

AysviL [449]3 years ago

3 0

Answer:

B. They oxidize hydrocarbons to form less toxic gases.

Explanation:

A catalytic converter can be defined as an anti-pollution device containing a catalyst like platinum-iridium, installed in the exhaust chamber of an automobile so as to chemically convert harmful (poisonous) pollutants such as unburned hydrocarbons and carbon monoxide (CO), sulfur dioxide (S02), nitrogen oxide (NO) etc., into less harmful, poisonous or toxic chemical compounds.

This ultimately implies that, catalytic converters are typically used for converting harmful gases into less harmful, poisonous or toxic gases and molecules e.g carbon dioxide (C02) and water (H2O). This helps to prevent global warming, enhance the conservation of natural resources, as well as preserve the lives of living organisms and their natural habitat.

<em>Hence, the statement which best describes the use of catalytic converters in automobiles is that they oxidize hydrocarbons to form less toxic gases.</em>

You might be interested in

Explain The element lithium has two common isotopes: Li–6 and Li–7 If the average atomic mass of lithium is 6.94004 u, determine

rosijanka [135]

Answer:

%Li-6 = 5.996% & %Li-7 = 94.004%

Explanation:

let X₁ = Li-6 & X₂ = Li-7 where Xₙ = mole fraction

X₁ + X₂ = 1 => X₁ = 1 - X₂

6·X₁ + 7·X₂ = 6.94004

=> 6(1 - X₂) + 7·X₂ = 6.94004

=> 6 - 6·X₂ + 7·X₂ = 6.94004

=> 6 + X₂ = 6.94004

X₂ = 6.94004 - 6 = 0.94004 => %X₂ = %Li-7 = 94.004%

X₁ = 1.00000 - 0.94004 = 0.05996 => %X₁ = %Li-6 = 5.996%

6 0

3 years ago

13. What does 2n^2 stand for?

Sever21 [200]

Answer:

2n² is a formula that determines that the maximum number of electrons should be accommodated in a particular shell.

Explanation:

4 0

2 years ago

A horse pulls on a cart with a force of 1800 newtons. The cart accelerates at the rate of 4.39 m/s2. According to Newton's law o

AlladinOne [14]

Answer:

Answer = 410.02277904328

Explanation:

1,800 N * $4.39m/s^2$ = 410.02277904328 m

hope this helps.

7 0

3 years ago

Help me:what helium <br> and what use

Naddik [55]

Answer:

the chemical element of atomic number 2, an inert gas which is the lightest member of the noble gas series.

Explanation:

Because it is very unreactive, helium is used to provide an inert protective atmosphere for making fibre optics and semiconductors, and for arc welding. Helium is also used to detect leaks, such as in car air-conditioning systems, and because it diffuses quickly it is used to inflate car airbags after impact.

8 0

3 years ago

50 points for anyone who answeres properly. How does a structure of a triglyceride differ from the reaction of fructose?

Nimfa-mama [501]

Answer:

Fatty Acids

A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.

Saturated Fatty Acids

In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.

Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.

Unsaturated Fatty Acids

In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.

Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.

Lipids and Diet

Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.

5 0

3 years ago