Answer:
K^+ and NO3^-
Explanation:
In a balanced ionic equation, we usually see the species that react to yield the main product in the reaction.
Consider the reaction;
Pb(NO3)2(aq) +2 KI(aq) -------> PbI2(s) + 2KNO3(aq)
The main product in this reaction is PbI2. Hence the balanced ionic equation is;
Pb^2+(aq) + 2I^-(aq) ------> PbI2(s)
Notice that K^+ and NO3^- did not participate in this reaction. All ions that are part of the molecular equation but do not participate in the ionic reaction equation are called spectator ions. Hence K^+ and NO3^- are spectator ions in this reaction as can be seen clearly above.
Answer:
G- Gallons-Miles
Explanation
Even though gallons of gas are converted to miles you cannot physically convert gallons of something to miles.
Answer:
please further explain your question
Answer : Electron P has greater energy difference than the Electron N.
Explanation :
Wavelength range of violet light = 400 - 500 nm
Wavelength range of orange light = 600 - 700 nm
The Planck's equation is,
where,
E = energy of light
c = speed of light
= wavelength of light
According to the Planck's equation, wavelength and energy follow inverse relation. As the wavelength increases, energy decreases.
From the given spectrum, the wavelength of violet light is less. We conclude that When electron P gives violet light on transition it means that energy difference between the energy level was high.
From the given spectrum, the wavelength of orange light is more. We conclude that When electron N gives orange light on transition it means that energy difference between the energy level was low.
So, Electron P which gives violet light on transition has greater energy difference than the Electron N.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
