It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
I’m going to say the answer is most likely X because memetic energy is energy being used at that moment. Because the coaster is going fastest at X we can assume that the answer is X
The inner diameter for a steel stack that exhausts 1,200 m3/min of gases at 1 atm and 400 k is 1.45 m
<h3>What is Stack Height ?</h3>
Stack height means the distance from the ground-level elevation at the base of the stack to the crown of the stack.
If a stack arises from a building or other structure, the ground-level elevation of that building or structure will be used as the base elevation of the stack.
Given is a steel stack that exhausts 1,200 cu.m/min of gases
P= 1 atm and
T= 400 K
maximum expected wind speed at stack height of 12 m/s
The formula for the diameter of chimney
Q =1200 cu.m/min
= 1200 * 0.0166 = 19.92 cu.m/sec
Velocity = 12m/s
d= 1.45 m
Therefore The inner diameter for a steel stack that exhausts 1,200 m3/min of gases at 1 atm and 400 k is 1.45 m.
To know more about Stack Height
brainly.com/question/24625453
#SPJ4
Answer:
1 True
2. True
3. True
4. True
5. False
Explanation:
1. Hypochlorous acid (HOCl) is a weak acid that forms when chlorine dissolves in water, and is partially dissociated, forming hypochlorite. HOCl is considered a strong oxidizing agent responsible for the killing action of germs in chlorine solutions.
2. Acetic acid is also known as ethanoic acid. It has a distinctive sour taste and pungent smell, and is generally considered a weak acid. in a concentrated form, acetic acid can be corrosive.
3/4 . Methylene chloride is an organochloride compound with the formula CH2Cl2. It is a colorless, volatile liquid with a moderately sweet aroma is widely used as a solvent. It is normally stable, non-flammable and non-explosive when mixed with air at temperatures below 100 °C, but its vapor is flammable only when present in relatively high concentrations of about 14% to 22% in air. Research shows that it is very much possibly carcinogenic, and it has been linked to cancer of the lungs, liver, pancreas, breast cancer and salivary gland cancer in laboratory animals.
5. Laboratory and medical waste are not to be disposed in the trash with regular wastes, as they are potentially toxic. Special disposal methods and agencies exists to take away such wastes.
Molar mass C6H12O6 = 12 x 6 + 1 x 12 + 16 x 6 = 180 g/mol
1 mole ------------ 180 g
( moles ) --------- 843.211 g
moles = 843.211 x 1 / 180
moles = 843.211 / 180
= 4,684 moles of C6H12O6
