It will take 1.11 min to heat the sample to its melting point.
Melting point = - 20°C
Boiling point = 85°C
∆H of fusion = 180 J/g
∆H of vap = 500 J/g
C(solid) = 1.0 J/g °C
C(liquid) = 2.5 J/g °C
C(gas) = 0.5 J/g °C
Mass of sample = 25 g
Initial temperature = - 40°C
Final temperature = 100°C
Rate of heating = 450 J/min
Specific heat capacity formula:- q = m ×C×∆T
Here, q = heat energy
m = mass
C = specific heat
∆T = temperature change
Melting point = - 20°C
C(solid) = 1.0 J/g °C
∆T = final temperature - initial temperature = -20 - (-40) = 20
Put these value in Specific heat capacity formula
q = m ×C×∆T
q = 25×1.0×20
=500J
The Rate of heating = 450 J/min
i.e. 450J = 1min
so, 500J = 1.11min
1.11 minutes does it take to heat the sample to its melting point.
The specific heat capacity is defined as the amount of heat absorbed in line with unit mass of the material whilst its temperature increases 1 °C.
Learn more about specific heat capacity here:- brainly.com/question/26866234
#SPJ4
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
As they contain, green pigement they can perform "Photosynthesis" and obtains energy from that process
Hope this helps!
I would say the second option
Hope this helps *smiles*