<span>It allows other scientists to check findings</span> is the most important reason to publish results as part of the scientific process.
Answer: I think the answer is 3.) Krypton or Argon.
Explanation:
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
1) The Kelvin temperature cannot be negative
2) The Kelvin degree is written as K, not ºK
Explanation:
The temperature of an object can be written using different temperature scales.
The two most important scales are:
- Celsius scale: the Celsius degree is indicated with ºC. It is based on the freezing point of water (placed at 0ºC) and the boiling point of water (100ºC).
- Kelvin scale: the Kelvin is indicated with K. it is based on the concept of "absolute zero" temperature, which is the temperature at which matter stops moving, and it is placed at zero Kelvin (0 K), so this scale cannot have negative temperatures, since 0 K is the lowest possible temperature.
The expression to convert from Celsius degrees to Kelvin is:

Therefore in this problem, since the student reported a temperature of -3.5 ºK, the errors done are:
1) The Kelvin temperature cannot be negative
2) The Kelvin degree is written as K, not ºK
Uranium provides nuclear fuel used generate electricity in nuclear power station,also used by the military to power nuclear submarines and in nuclear weapons.