Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
I assume that it is herring
Answer:
The empirical formula for the compound is C3H4O3
Explanation:
The following data were obtained from the question:
Carbon (C) = 40.92%
Hydrogen (H) = 4.58%
Oxygen (O) = 54.50%
The empirical formula for the compound can be obtained as follow:
C = 40.92%
H = 4.58%
O = 54.50%
Divide by their molar mass
C = 40.92/12 = 3.41
H = 4.58/1 = 4.58
O = 54.50/16 = 3.41
Divide by the smallest i.e 3.41
C = 3.41/3.41 = 1
H = 4.58/3.41 = 1.3
O = 3.41/3.41 = 1
Multiply through by 3 to express in whole number
C = 1 x 3 = 3
H = 1.3 x 3 = 4
O = 1 x 3 = 3
The empirical formula for the compound is C3H4O3
<u>Given:</u>
Surface area at the narrow end, A1 = 5.00 cm2
Force applied at the narrow end, F1 = 81.0 N
Surface area at the wide end, A2 = 725 cm2
<u>To determine:</u>
Force F2 applied at the wide end
<u>Explanation:</u>
Use the relation
F1/A1 = F2/A2
F2 = F1*A2/A1 = 81.0 N * 725 cm2/5.00 cm2 = 11,745 N
Ans: (b)
The force applied at the wide end = 11,745 N
