Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
<span>In physics, the law of conservation of energy states that the total energy of an isolated system remains constant—it is said to be conserved over time. Energy can neither be created nor destroyed; rather, it transforms from one form to another.</span>
Mud has alot of water so it's easier for them to live in.
The different types of microscopes are all necessary because not all experiments require the same level of magnification. For dissections low magnification is sufficient, so a dissecting microscope works very well, while for viewing single cells the 1000 fold magnification of a compound light microscope is more accurate.
2KClO3 --> 2KClO2 + O2
12 6 (moles)
The ratio of KClO3 and O2 is 2:1. This means 2 moles of KClO3 can create 1 mole of O2. So 12 moles of KClO3 will create 6 moles of O2.
