Could an organism survive without its mitochondria if all the other organelle were present

2 answers:

8 0

No, <span>mitochondria convert the sugar, can give it(the cell) Nutrients (food) to mainly keep it fresh and alive. Without cells mitochondria can't do its job.</span>

Vaselesa [24]3 years ago

4 0

Higher animals would likely not exist bc their cells would only be able to obtain energy from anaerobic respiration

You might be interested in

All matter on earth contains energy

Dafna11 [192]

Yes; every object has energy and you cannot create or destroy energy but you can transfer it.

6 0

3 years ago

Is burning sugar a chemical or physical change? Please provide explanation

solong [7]

Answer:

It is a chemical change

Explanation:

the reason is because the will not be able to materialize back into it's original form.

6 0

3 years ago

Read 2 more answers

Helpppppp!!!!! It’s due today <br> URGENT!!!!!

VladimirAG [237]

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

5 0

3 years ago

What is the meaning of a chemical reaction?

Margarita [4]

When you have a chemical reaction, it means something goes wrong with your chemicals.

5 0

3 years ago

Read 2 more answers

The molar mass of Cr(OH)2 is:

son4ous [18]

The molar mass of $Cr(OH)_2$ is 86.02 g/mole .

<h3><u> Explanation:</u> </h3>

The molar mass of a chemical compound is represented as the mass of a unit of that compound separated by the number of substances in that unit, measured in moles. The molar mass is a volume, not molecular, the property of a substance.

The molar mass is a percentage of various examples of the compound, which usually change in mass due to the appearance of isotopes.

From the below attached table, the Molar mass of $Cr(OH)_2$ is 86.0108 g/mol.

3 0

3 years ago